C36H35N4O5P — CID 91931138
benzyl N-[(2R)-1-[[2-(4-carbamimidoylphenyl)-1-[dihydroxy(phenyl)-λ5-phosphanylidene]ethyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate (PubChem CID 91931138) has the molecular formula C36H35N4O5P and a molecular weight of 634.67 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[[2-(4-carbamimidoylphenyl)-1-[dihydroxy(phenyl)-λ5-phosphanylidene]ethyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[[2-(4-carbamimidoylphenyl)-1-[dihydroxy(phenyl)-λ5-phosphanylidene]ethyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91931138 |
| Molecular Formula | C36H35N4O5P |
| Molecular Weight | 634.67 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | benzyl N-[(2R)-1-[[2-(4-carbamimidoylphenyl)-1-[dihydroxy(phenyl)-λ5-phosphanylidene]ethyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(CC(NC(=O)[C@@H](Cc2ccc3ccccc3c2)NC(=O)OCc2ccccc2)=P(O)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35N4O5P/c37-34(38)29-19-15-25(16-20-29)23-33(46(43,44)31-13-5-2-6-14-31)40-35(41)32(39-36(42)45-24-26-9-3-1-4-10-26)22-27-17-18-28-11-7-8-12-30(28)21-27/h1-21,32,43-44H,22-24H2,(H3,37,38)(H,39,42)(H,40,41)/t32-/m1/s1 |
| InChIKey | XWBDKDUEXQUPGK-JGCGQSQUSA-N |
| XLogP | 4.61 |
| TPSA | 157.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|