C28H27ClN3O5P — CID 11548492
benzyl N-[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate;hydrochloride (PubChem CID 11548492) has the molecular formula C28H27ClN3O5P and a molecular weight of 551.97 g/mol. Its IUPAC name is benzyl N-[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 11548492 |
| Molecular Formula | C28H27ClN3O5P |
| Molecular Weight | 551.97 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | benzyl N-[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C(NC(=O)OCc2ccccc2)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N3O5P.ClH/c29-26(30)22-16-18-23(19-17-22)27(31-28(32)34-20-21-10-4-1-5-11-21)37(33,35-24-12-6-2-7-13-24)36-25-14-8-3-9-15-25;/h1-19,27H,20H2,(H3,29,30)(H,31,32);1H |
| InChIKey | KJDRMXGHEINYCK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.97 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|