C29H28N3O7P — CID 155527418
benzyl N-[[4-(dimethylamino)-3-nitrophenyl]-diphenoxyphosphorylmethyl]carbamate (PubChem CID 155527418) has the molecular formula C29H28N3O7P and a molecular weight of 561.53 g/mol. Its IUPAC name is benzyl N-[[4-(dimethylamino)-3-nitrophenyl]-diphenoxyphosphorylmethyl]carbamate.
| Compound Name | benzyl N-[[4-(dimethylamino)-3-nitrophenyl]-diphenoxyphosphorylmethyl]carbamate |
|---|---|
| PubChem CID | 155527418 |
| Molecular Formula | C29H28N3O7P |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | benzyl N-[[4-(dimethylamino)-3-nitrophenyl]-diphenoxyphosphorylmethyl]carbamate |
| SMILES | CN(C)c1ccc(C(NC(=O)OCc2ccccc2)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H28N3O7P/c1-31(2)26-19-18-23(20-27(26)32(34)35)28(30-29(33)37-21-22-12-6-3-7-13-22)40(36,38-24-14-8-4-9-15-24)39-25-16-10-5-11-17-25/h3-20,28H,21H2,1-2H3,(H,30,33) |
| InChIKey | MGHCTLAQRNFZQB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|