C29H40N6O5S — CID 130388890
methyl 4-[1-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfinylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]butanoate (PubChem CID 130388890) has the molecular formula C29H40N6O5S and a molecular weight of 584.74 g/mol. Its IUPAC name is methyl 4-[1-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfinylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]butanoate.
| Compound Name | methyl 4-[1-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfinylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 130388890 |
| Molecular Formula | C29H40N6O5S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | methyl 4-[1-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfinylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperidin-4-yl]butanoate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)c2cccc(NC(=O)CCN)c2)C(=O)N2CCC(CCCC(=O)OC)CC2)c1 |
| InChI | InChI=1S/C29H40N6O5S/c1-40-27(37)10-3-5-20-12-15-35(16-13-20)29(38)25(18-21-6-2-7-22(17-21)28(31)32)34-41(39)24-9-4-8-23(19-24)33-26(36)11-14-30/h2,4,6-9,17,19-20,25,34H,3,5,10-16,18,30H2,1H3,(H3,31,32)(H,33,36)/t25-,41?/m0/s1 |
| InChIKey | PKLOWCAVYWPGKT-LZBJMVSRSA-N |
| XLogP | 2.06 |
| TPSA | 180.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|