C32H38N6OS2 — CID 168913554
3-[2-[6-[3-(1H-imidazol-2-yl)propoxy]-1,3-benzothiazol-2-yl]-2-(phenylsulfanylamino)ethyl]benzenecarboximidamide;2-methylpropane (PubChem CID 168913554) has the molecular formula C32H38N6OS2 and a molecular weight of 586.83 g/mol. Its IUPAC name is 3-[2-[6-[3-(1H-imidazol-2-yl)propoxy]-1,3-benzothiazol-2-yl]-2-(phenylsulfanylamino)ethyl]benzenecarboximidamide;2-methylpropane.
| Compound Name | 3-[2-[6-[3-(1H-imidazol-2-yl)propoxy]-1,3-benzothiazol-2-yl]-2-(phenylsulfanylamino)ethyl]benzenecarboximidamide;2-methylpropane |
|---|---|
| PubChem CID | 168913554 |
| Molecular Formula | C32H38N6OS2 |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 3-[2-[6-[3-(1H-imidazol-2-yl)propoxy]-1,3-benzothiazol-2-yl]-2-(phenylsulfanylamino)ethyl]benzenecarboximidamide;2-methylpropane |
| SMILES | CC(C)C.[H]/N=C(\N)c1cccc(CC(NSc2ccccc2)c2nc3ccc(OCCCc4ncc[nH]4)cc3s2)c1 |
| InChI | InChI=1S/C28H28N6OS2.C4H10/c29-27(30)20-7-4-6-19(16-20)17-24(34-37-22-8-2-1-3-9-22)28-33-23-12-11-21(18-25(23)36-28)35-15-5-10-26-31-13-14-32-26;1-4(2)3/h1-4,6-9,11-14,16,18,24,34H,5,10,15,17H2,(H3,29,30)(H,31,32);4H,1-3H3 |
| InChIKey | NUWYYDCBCAHRIE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|