C23H23N3OS2 — CID 168913677
3-[[1-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline (PubChem CID 168913677) has the molecular formula C23H23N3OS2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-[[1-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline.
| Compound Name | 3-[[1-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline |
|---|---|
| PubChem CID | 168913677 |
| Molecular Formula | C23H23N3OS2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-[[1-(6-methoxy-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylaniline |
| SMILES | COc1ccc2nc(C(Cc3cccc(C)c3)NSc3cccc(N)c3)sc2c1 |
| InChI | InChI=1S/C23H23N3OS2/c1-15-5-3-6-16(11-15)12-21(26-29-19-8-4-7-17(24)13-19)23-25-20-10-9-18(27-2)14-22(20)28-23/h3-11,13-14,21,26H,12,24H2,1-2H3 |
| InChIKey | ODYVUMIJGIKZOX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|