About 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine
1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine (PubChem CID 168913340) has the molecular formula C24H24N2S2
and a molecular weight of 404.60 g/mol. Its IUPAC name is 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine.
Molecular Properties
| Compound Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine |
| PubChem CID | 168913340 |
| Molecular Formula | C24H24N2S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine |
| SMILES | CCc1ccc2nc(C(Cc3cccc(C)c3)NSc3ccccc3)sc2c1 |
| InChI | InChI=1S/C24H24N2S2/c1-3-18-12-13-21-23(16-18)27-24(25-21)22(15-19-9-7-8-17(2)14-19)26-28-20-10-5-4-6-11-20/h4-14,16,22,26H,3,15H2,1-2H3 |
| InChIKey | RIXXPTRNCLTXRU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine?
The IUPAC name of 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine (CID 168913340) is 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine.
What is the SMILES notation for 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine?
The canonical SMILES for 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine is CCc1ccc2nc(C(Cc3cccc(C)c3)NSc3ccccc3)sc2c1.
What is the InChIKey of 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine?
The InChIKey is RIXXPTRNCLTXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2S2/c1-3-18-12-13-21-23(16-18)27-24(25-21)22(15-19-9-7-8-17(2)14-19)26-28-20-10-5-4-6-11-20/h4-14,16,22,26H,3,15H2,1-2H3.
What are the key properties of 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine?
1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine has a molecular weight of 404.60 g/mol, XLogP of 6.75, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-ethyl-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)-N-phenylsulfanylethanamine is sourced from PubChem (CID 168913340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).