C29H25N3OS2 — CID 168913357
N-[3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylphenyl]benzamide (PubChem CID 168913357) has the molecular formula C29H25N3OS2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylphenyl]benzamide.
| Compound Name | N-[3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 168913357 |
| Molecular Formula | C29H25N3OS2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-[3-[[1-(1,3-benzothiazol-2-yl)-2-(3-methylphenyl)ethyl]amino]sulfanylphenyl]benzamide |
| SMILES | Cc1cccc(CC(NSc2cccc(NC(=O)c3ccccc3)c2)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C29H25N3OS2/c1-20-9-7-10-21(17-20)18-26(29-31-25-15-5-6-16-27(25)34-29)32-35-24-14-8-13-23(19-24)30-28(33)22-11-3-2-4-12-22/h2-17,19,26,32H,18H2,1H3,(H,30,33) |
| InChIKey | DSOMOAUCSXBXJB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|