C27H33N5O2S2 — CID 168913161
3-[2-(6-butoxy-1,3-benzothiazol-2-yl)-2-phenylethyl]benzenecarboximidamide;formamide;thiohydroxylamine (PubChem CID 168913161) has the molecular formula C27H33N5O2S2 and a molecular weight of 523.73 g/mol. Its IUPAC name is 3-[2-(6-butoxy-1,3-benzothiazol-2-yl)-2-phenylethyl]benzenecarboximidamide;formamide;thiohydroxylamine.
| Compound Name | 3-[2-(6-butoxy-1,3-benzothiazol-2-yl)-2-phenylethyl]benzenecarboximidamide;formamide;thiohydroxylamine |
|---|---|
| PubChem CID | 168913161 |
| Molecular Formula | C27H33N5O2S2 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 3-[2-(6-butoxy-1,3-benzothiazol-2-yl)-2-phenylethyl]benzenecarboximidamide;formamide;thiohydroxylamine |
| SMILES | NC=O.NS.[H]/N=C(\N)c1cccc(CC(c2ccccc2)c2nc3ccc(OCCCC)cc3s2)c1 |
| InChI | InChI=1S/C26H27N3OS.CH3NO.H3NS/c1-2-3-14-30-21-12-13-23-24(17-21)31-26(29-23)22(19-9-5-4-6-10-19)16-18-8-7-11-20(15-18)25(27)28;2-1-3;1-2/h4-13,15,17,22H,2-3,14,16H2,1H3,(H3,27,28);1H,(H2,2,3);2H,1H2 |
| InChIKey | LWTVPNGHJJENMO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|