About 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole
3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole (PubChem CID 168913522) has the molecular formula C17H20N4OS
and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole |
| PubChem CID | 168913522 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole |
| SMILES | CCc1nc2ccc(OC)cc2s1.[H]/N=C(\N)c1cccc(N)c1 |
| InChI | InChI=1S/C10H11NOS.C7H9N3/c1-3-10-11-8-5-4-7(12-2)6-9(8)13-10;8-6-3-1-2-5(4-6)7(9)10/h4-6H,3H2,1-2H3;1-4H,8H2,(H3,9,10) |
| InChIKey | DQSPIPVGISMADX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole?
The IUPAC name of 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole (CID 168913522) is 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole.
What is the SMILES notation for 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole?
The canonical SMILES for 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole is CCc1nc2ccc(OC)cc2s1.[H]/N=C(\N)c1cccc(N)c1.
What is the InChIKey of 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole?
The InChIKey is DQSPIPVGISMADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS.C7H9N3/c1-3-10-11-8-5-4-7(12-2)6-9(8)13-10;8-6-3-1-2-5(4-6)7(9)10/h4-6H,3H2,1-2H3;1-4H,8H2,(H3,9,10).
What are the key properties of 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole?
3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole has a molecular weight of 328.44 g/mol, XLogP of 3.42, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole is sourced from PubChem (CID 168913522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).