C17H20N4OS — CID 168913522
3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole (PubChem CID 168913522) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole.
| Compound Name | 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 168913522 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-aminobenzenecarboximidamide;2-ethyl-6-methoxy-1,3-benzothiazole |
| SMILES | CCc1nc2ccc(OC)cc2s1.[H]/N=C(\N)c1cccc(N)c1 |
| InChI | InChI=1S/C10H11NOS.C7H9N3/c1-3-10-11-8-5-4-7(12-2)6-9(8)13-10;8-6-3-1-2-5(4-6)7(9)10/h4-6H,3H2,1-2H3;1-4H,8H2,(H3,9,10) |
| InChIKey | DQSPIPVGISMADX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|