C13H11NOS2 — CID 67564031
6-methoxy-2-(thiophen-2-ylmethyl)-1,3-benzothiazole (PubChem CID 67564031) has the molecular formula C13H11NOS2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 6-methoxy-2-(thiophen-2-ylmethyl)-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-(thiophen-2-ylmethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 67564031 |
| Molecular Formula | C13H11NOS2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 6-methoxy-2-(thiophen-2-ylmethyl)-1,3-benzothiazole |
| SMILES | COc1ccc2nc(Cc3cccs3)sc2c1 |
| InChI | InChI=1S/C13H11NOS2/c1-15-9-4-5-11-12(7-9)17-13(14-11)8-10-3-2-6-16-10/h2-7H,8H2,1H3 |
| InChIKey | FQVRCAVBDQOBFP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |