C29H31N5O4S — CID 168913532
3-[[(1S)-2-(3-carbamimidoylphenyl)-1-(3H-indol-2-yl)ethyl]sulfamoyl]-N-(oxan-4-yl)benzamide (PubChem CID 168913532) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is 3-[[(1S)-2-(3-carbamimidoylphenyl)-1-(3H-indol-2-yl)ethyl]sulfamoyl]-N-(oxan-4-yl)benzamide.
| Compound Name | 3-[[(1S)-2-(3-carbamimidoylphenyl)-1-(3H-indol-2-yl)ethyl]sulfamoyl]-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 168913532 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 3-[[(1S)-2-(3-carbamimidoylphenyl)-1-(3H-indol-2-yl)ethyl]sulfamoyl]-N-(oxan-4-yl)benzamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2cccc(C(=O)NC3CCOCC3)c2)C2=Nc3ccccc3C2)c1 |
| InChI | InChI=1S/C29H31N5O4S/c30-28(31)21-7-3-5-19(15-21)16-27(26-18-20-6-1-2-10-25(20)33-26)34-39(36,37)24-9-4-8-22(17-24)29(35)32-23-11-13-38-14-12-23/h1-10,15,17,23,27,34H,11-14,16,18H2,(H3,30,31)(H,32,35)/t27-/m0/s1 |
| InChIKey | GLCVJXPULVFZTJ-MHZLTWQESA-N |
| XLogP | 3.10 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|