C13H16ClN3O2S2 — CID 75441285
3-chloro-N-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide (PubChem CID 75441285) has the molecular formula C13H16ClN3O2S2 and a molecular weight of 345.88 g/mol. Its IUPAC name is 3-chloro-N-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75441285 |
| Molecular Formula | C13H16ClN3O2S2 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-chloro-N-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzenesulfonamide |
| SMILES | CC(NCCNS(=O)(=O)c1cccc(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C13H16ClN3O2S2/c1-10(13-16-7-8-20-13)15-5-6-17-21(18,19)12-4-2-3-11(14)9-12/h2-4,7-10,15,17H,5-6H2,1H3 |
| InChIKey | IKCAQOPFSRPXSP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|