C30H37N5O4S — CID 91252583
N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-1-[3-(N'-hydroxycarbamimidoyl)anilino]cyclohexane-1-carboxamide (PubChem CID 91252583) has the molecular formula C30H37N5O4S and a molecular weight of 563.72 g/mol. Its IUPAC name is N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-1-[3-(N'-hydroxycarbamimidoyl)anilino]cyclohexane-1-carboxamide.
| Compound Name | N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-1-[3-(N'-hydroxycarbamimidoyl)anilino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91252583 |
| Molecular Formula | C30H37N5O4S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-1-[3-(N'-hydroxycarbamimidoyl)anilino]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1ccc(NC(=O)C2(Nc3cccc(C(N)=NO)c3)CCCCC2)cc1 |
| InChI | InChI=1S/C30H37N5O4S/c1-29(2,3)35-40(38,39)26-13-6-5-12-25(26)21-14-16-23(17-15-21)32-28(36)30(18-7-4-8-19-30)33-24-11-9-10-22(20-24)27(31)34-37/h5-6,9-17,20,33,35,37H,4,7-8,18-19H2,1-3H3,(H2,31,34)(H,32,36) |
| InChIKey | NZSYPZRMASJFAG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|