C19H20N2O — CID 135016973
2,5,6-trimethyl-N-(4-methylphenyl)-1H-indole-3-carboxamide (PubChem CID 135016973) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,5,6-trimethyl-N-(4-methylphenyl)-1H-indole-3-carboxamide.
| Compound Name | 2,5,6-trimethyl-N-(4-methylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 135016973 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2,5,6-trimethyl-N-(4-methylphenyl)-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(C)[nH]c3cc(C)c(C)cc23)cc1 |
| InChI | InChI=1S/C19H20N2O/c1-11-5-7-15(8-6-11)21-19(22)18-14(4)20-17-10-13(3)12(2)9-16(17)18/h5-10,20H,1-4H3,(H,21,22) |
| InChIKey | IKUCVQDLKFWZAB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |