C23H19N3O2S — CID 10225096
6-carbamimidoyl-4-(5-methylsulfanylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide (PubChem CID 10225096) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 6-carbamimidoyl-4-(5-methylsulfanylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 6-carbamimidoyl-4-(5-methylsulfanylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 10225096 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 6-carbamimidoyl-4-(5-methylsulfanylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)Nc3ccccc3)cc(-c3coc(SC)c3)c2c1 |
| InChI | InChI=1S/C23H19N3O2S/c1-29-21-12-17(13-28-21)20-11-16(23(27)26-18-5-3-2-4-6-18)9-14-7-8-15(22(24)25)10-19(14)20/h2-13H,1H3,(H3,24,25)(H,26,27) |
| InChIKey | KLKFHGGCLXSCLN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|