C24H22ClN3O4S — CID 10140846
6-carbamimidoyl-4-(5-ethylsulfonylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide;hydrochloride (PubChem CID 10140846) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is 6-carbamimidoyl-4-(5-ethylsulfonylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide;hydrochloride.
| Compound Name | 6-carbamimidoyl-4-(5-ethylsulfonylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 10140846 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 6-carbamimidoyl-4-(5-ethylsulfonylfuran-3-yl)-N-phenylnaphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2cc(C(=O)Nc3ccccc3)cc(-c3coc(S(=O)(=O)CC)c3)c2c1 |
| InChI | InChI=1S/C24H21N3O4S.ClH/c1-2-32(29,30)22-13-18(14-31-22)21-12-17(24(28)27-19-6-4-3-5-7-19)10-15-8-9-16(23(25)26)11-20(15)21;/h3-14H,2H2,1H3,(H3,25,26)(H,27,28);1H |
| InChIKey | LEWVLUFXZBFIFF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|