C24H22ClN3O3 — CID 162325916
6-methanehydrazonoyl-4-[5-(methoxymethyl)furan-3-yl]-N-phenylnaphthalene-2-carboxamide;hydrochloride (PubChem CID 162325916) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is 6-methanehydrazonoyl-4-[5-(methoxymethyl)furan-3-yl]-N-phenylnaphthalene-2-carboxamide;hydrochloride.
| Compound Name | 6-methanehydrazonoyl-4-[5-(methoxymethyl)furan-3-yl]-N-phenylnaphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162325916 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 6-methanehydrazonoyl-4-[5-(methoxymethyl)furan-3-yl]-N-phenylnaphthalene-2-carboxamide;hydrochloride |
| SMILES | COCc1cc(-c2cc(C(=O)Nc3ccccc3)cc3ccc(C=NN)cc23)co1.Cl |
| InChI | InChI=1S/C24H21N3O3.ClH/c1-29-15-21-11-19(14-30-21)23-12-18(24(28)27-20-5-3-2-4-6-20)10-17-8-7-16(13-26-25)9-22(17)23;/h2-14H,15,25H2,1H3,(H,27,28);1H |
| InChIKey | SOVNEEOMANCNIW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|