C16H15N3O3 — CID 70209280
2-[3-[(3-methanehydrazonoylbenzoyl)amino]phenyl]acetic acid (PubChem CID 70209280) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[3-[(3-methanehydrazonoylbenzoyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(3-methanehydrazonoylbenzoyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 70209280 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[3-[(3-methanehydrazonoylbenzoyl)amino]phenyl]acetic acid |
| SMILES | NN=Cc1cccc(C(=O)Nc2cccc(CC(=O)O)c2)c1 |
| InChI | InChI=1S/C16H15N3O3/c17-18-10-12-4-1-5-13(7-12)16(22)19-14-6-2-3-11(8-14)9-15(20)21/h1-8,10H,9,17H2,(H,19,22)(H,20,21) |
| InChIKey | XPHXFXBAQZJHBF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|