C17H15N5O3 — CID 70062661
2-[6-[(4-methanehydrazonoylbenzoyl)amino]-1H-benzimidazol-2-yl]acetic acid (PubChem CID 70062661) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[6-[(4-methanehydrazonoylbenzoyl)amino]-1H-benzimidazol-2-yl]acetic acid.
| Compound Name | 2-[6-[(4-methanehydrazonoylbenzoyl)amino]-1H-benzimidazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 70062661 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[6-[(4-methanehydrazonoylbenzoyl)amino]-1H-benzimidazol-2-yl]acetic acid |
| SMILES | NN=Cc1ccc(C(=O)Nc2ccc3nc(CC(=O)O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C17H15N5O3/c18-19-9-10-1-3-11(4-2-10)17(25)20-12-5-6-13-14(7-12)22-15(21-13)8-16(23)24/h1-7,9H,8,18H2,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | LPMBCWGWDLVSGL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|