C23H18N6O6 — CID 139827225
4-nitro-N-[2-[6-[(4-nitrobenzoyl)amino]-1H-benzimidazol-2-yl]ethyl]benzamide (PubChem CID 139827225) has the molecular formula C23H18N6O6 and a molecular weight of 474.43 g/mol. Its IUPAC name is 4-nitro-N-[2-[6-[(4-nitrobenzoyl)amino]-1H-benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-nitro-N-[2-[6-[(4-nitrobenzoyl)amino]-1H-benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 139827225 |
| Molecular Formula | C23H18N6O6 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 4-nitro-N-[2-[6-[(4-nitrobenzoyl)amino]-1H-benzimidazol-2-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1nc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18N6O6/c30-22(14-1-6-17(7-2-14)28(32)33)24-12-11-21-26-19-10-5-16(13-20(19)27-21)25-23(31)15-3-8-18(9-4-15)29(34)35/h1-10,13H,11-12H2,(H,24,30)(H,25,31)(H,26,27) |
| InChIKey | CIMHZHFWZBHYTB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 173.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|