C22H20ClFN4O3 — CID 86589997
2-fluoro-4-methanehydrazonoyl-N-[2-[(4-methoxybenzoyl)amino]phenyl]benzamide;hydrochloride (PubChem CID 86589997) has the molecular formula C22H20ClFN4O3 and a molecular weight of 442.88 g/mol. Its IUPAC name is 2-fluoro-4-methanehydrazonoyl-N-[2-[(4-methoxybenzoyl)amino]phenyl]benzamide;hydrochloride.
| Compound Name | 2-fluoro-4-methanehydrazonoyl-N-[2-[(4-methoxybenzoyl)amino]phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 86589997 |
| Molecular Formula | C22H20ClFN4O3 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-fluoro-4-methanehydrazonoyl-N-[2-[(4-methoxybenzoyl)amino]phenyl]benzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)Nc2ccccc2NC(=O)c2ccc(C=NN)cc2F)cc1.Cl |
| InChI | InChI=1S/C22H19FN4O3.ClH/c1-30-16-9-7-15(8-10-16)21(28)26-19-4-2-3-5-20(19)27-22(29)17-11-6-14(13-25-24)12-18(17)23;/h2-13H,24H2,1H3,(H,26,28)(H,27,29);1H |
| InChIKey | PDMVMEFARDNIDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|