C20H20N2O5S — CID 162176375
2-(6-carbamimidoylnaphthalen-2-yl)-2-phenylacetic acid;methanesulfonic acid (PubChem CID 162176375) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)-2-phenylacetic acid;methanesulfonic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)-2-phenylacetic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 162176375 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)-2-phenylacetic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(C(C(=O)O)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C19H16N2O2.CH4O3S/c20-18(21)16-9-7-13-10-15(8-6-14(13)11-16)17(19(22)23)12-4-2-1-3-5-12;1-5(2,3)4/h1-11,17H,(H3,20,21)(H,22,23);1H3,(H,2,3,4) |
| InChIKey | AYSSPZLJOBGCPI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|