C14H14N2O2 — CID 140981325
2-(7-carbamimidoylnaphthalen-2-yl)propanoic acid (PubChem CID 140981325) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(7-carbamimidoylnaphthalen-2-yl)propanoic acid.
| Compound Name | 2-(7-carbamimidoylnaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 140981325 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(7-carbamimidoylnaphthalen-2-yl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2ccc(C(C)C(=O)O)cc2c1 |
| InChI | InChI=1S/C14H14N2O2/c1-8(14(17)18)10-4-2-9-3-5-11(13(15)16)7-12(9)6-10/h2-8H,1H3,(H3,15,16)(H,17,18) |
| InChIKey | VNVRVVDSUWJFMQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|