C10H13N5 — CID 83881571
2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine-7-carboximidamide (PubChem CID 83881571) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine-7-carboximidamide.
| Compound Name | 2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 83881571 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine-7-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccn2nc(C(C)C)nc2c1 |
| InChI | InChI=1S/C10H13N5/c1-6(2)10-13-8-5-7(9(11)12)3-4-15(8)14-10/h3-6H,1-2H3,(H3,11,12) |
| InChIKey | IUJYNJSJQZINEK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|