C11H14N2 — CID 20814090
7,8-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene-3-carboximidamide (PubChem CID 20814090) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 7,8-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene-3-carboximidamide.
| Compound Name | 7,8-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene-3-carboximidamide |
|---|---|
| PubChem CID | 20814090 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7,8-dimethylbicyclo[4.2.0]octa-1(6),2,4-triene-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C(C)C2C |
| InChI | InChI=1S/C11H14N2/c1-6-7(2)10-5-8(11(12)13)3-4-9(6)10/h3-7H,1-2H3,(H3,12,13) |
| InChIKey | KOQVURVWVQZEOQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|