C7H6N4O — CID 140791723
2,1,3-benzoxadiazole-5-carboximidamide (PubChem CID 140791723) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is 2,1,3-benzoxadiazole-5-carboximidamide.
| Compound Name | 2,1,3-benzoxadiazole-5-carboximidamide |
|---|---|
| PubChem CID | 140791723 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 2,1,3-benzoxadiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nonc2c1 |
| InChI | InChI=1S/C7H6N4O/c8-7(9)4-1-2-5-6(3-4)11-12-10-5/h1-3H,(H3,8,9) |
| InChIKey | HLMQGVGFCPUJQL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|