C7H6N4O2 — CID 2821550
N'-hydroxy-2,1,3-benzoxadiazole-5-carboximidamide (PubChem CID 2821550) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is N'-hydroxy-2,1,3-benzoxadiazole-5-carboximidamide.
| Compound Name | N'-hydroxy-2,1,3-benzoxadiazole-5-carboximidamide |
|---|---|
| PubChem CID | 2821550 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | N'-hydroxy-2,1,3-benzoxadiazole-5-carboximidamide |
| SMILES | NC(=NO)c1ccc2nonc2c1 |
| InChI | InChI=1S/C7H6N4O2/c8-7(9-12)4-1-2-5-6(3-4)11-13-10-5/h1-3,12H,(H2,8,9) |
| InChIKey | OJACFSFQINRGNT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|