C11H12BrN5 — CID 82799867
3-bromo-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzenecarboximidamide (PubChem CID 82799867) has the molecular formula C11H12BrN5 and a molecular weight of 294.16 g/mol. Its IUPAC name is 3-bromo-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 82799867 |
| Molecular Formula | C11H12BrN5 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-bromo-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-n2nc(C)nc2C)c(Br)c1 |
| InChI | InChI=1S/C11H12BrN5/c1-6-15-7(2)17(16-6)10-4-3-8(11(13)14)5-9(10)12/h3-5H,1-2H3,(H3,13,14) |
| InChIKey | LFOPVMDRHURGNX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|