C12H16BrN3S — CID 82799956
3-bromo-4-(1,4-thiazepan-4-yl)benzenecarboximidamide (PubChem CID 82799956) has the molecular formula C12H16BrN3S and a molecular weight of 314.25 g/mol. Its IUPAC name is 3-bromo-4-(1,4-thiazepan-4-yl)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(1,4-thiazepan-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 82799956 |
| Molecular Formula | C12H16BrN3S |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-bromo-4-(1,4-thiazepan-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCSCC2)c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3S/c13-10-8-9(12(14)15)2-3-11(10)16-4-1-6-17-7-5-16/h2-3,8H,1,4-7H2,(H3,14,15) |
| InChIKey | CBMSCGSLNDXEIF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|