C14H20BrN3O — CID 102958445
3-bromo-4-(3-methoxy-4-methylpiperidin-1-yl)benzenecarboximidamide (PubChem CID 102958445) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 3-bromo-4-(3-methoxy-4-methylpiperidin-1-yl)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(3-methoxy-4-methylpiperidin-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 102958445 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-bromo-4-(3-methoxy-4-methylpiperidin-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(C)C(OC)C2)c(Br)c1 |
| InChI | InChI=1S/C14H20BrN3O/c1-9-5-6-18(8-13(9)19-2)12-4-3-10(14(16)17)7-11(12)15/h3-4,7,9,13H,5-6,8H2,1-2H3,(H3,16,17) |
| InChIKey | AOUCTGXVFUACLH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|