C13H18BrN3O2 — CID 103534136
3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)benzenecarboximidamide (PubChem CID 103534136) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 103534136 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(OC)C(OC)C2)c(Br)c1 |
| InChI | InChI=1S/C13H18BrN3O2/c1-18-11-6-17(7-12(11)19-2)10-4-3-8(13(15)16)5-9(10)14/h3-5,11-12H,6-7H2,1-2H3,(H3,15,16) |
| InChIKey | XSCSYHIXRIFEAU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|