C15H23N3O2 — CID 103534175
4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-3-methylbenzenecarboximidamide (PubChem CID 103534175) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-3-methylbenzenecarboximidamide.
| Compound Name | 4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 103534175 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-3-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CC(OC)C(OC)C2)c(C)c1 |
| InChI | InChI=1S/C15H23N3O2/c1-10-6-11(15(16)17)4-5-12(10)7-18-8-13(19-2)14(9-18)20-3/h4-6,13-14H,7-9H2,1-3H3,(H3,16,17) |
| InChIKey | IABLBWDCSJQBNT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|