C15H22BrN3 — CID 82799217
3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzenecarboximidamide (PubChem CID 82799217) has the molecular formula C15H22BrN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 82799217 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(CC)(CC)C2)c(Br)c1 |
| InChI | InChI=1S/C15H22BrN3/c1-3-15(4-2)7-8-19(10-15)13-6-5-11(14(17)18)9-12(13)16/h5-6,9H,3-4,7-8,10H2,1-2H3,(H3,17,18) |
| InChIKey | CLWBVHYAGWGHOS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|