3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid

C15H20BrNO2 — CID 82800705

IUPAC3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid
SMILESCCC1(CC)CCN(c2ccc(C(=O)O)cc2Br)C1
InChIInChI=1S/C15H20BrNO2/c1-3-15(4-2)7-8-17(10-15)13-6-5-11(14(18)19)9-12(13)16/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,18,19)
InChIKeyJSGRJNPYQPORBD-UHFFFAOYSA-N
MW326.23 g/mol
LogP4.16
Rot. Bonds4

About 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid

3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid (PubChem CID 82800705) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid.

Molecular Properties

Compound Name3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid
PubChem CID82800705
Molecular FormulaC15H20BrNO2
Molecular Weight326.23 g/mol
Exact Mass325.07
IUPAC Name3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid
SMILESCCC1(CC)CCN(c2ccc(C(=O)O)cc2Br)C1
InChIInChI=1S/C15H20BrNO2/c1-3-15(4-2)7-8-17(10-15)13-6-5-11(14(18)19)9-12(13)16/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,18,19)
InChIKeyJSGRJNPYQPORBD-UHFFFAOYSA-N
XLogP4.16
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.23
LogP ≤ 54.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid?
The IUPAC name of 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid (CID 82800705) is 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid.
What is the SMILES notation for 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid?
The canonical SMILES for 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid is CCC1(CC)CCN(c2ccc(C(=O)O)cc2Br)C1.
What is the InChIKey of 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid?
The InChIKey is JSGRJNPYQPORBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO2/c1-3-15(4-2)7-8-17(10-15)13-6-5-11(14(18)19)9-12(13)16/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,18,19).
What are the key properties of 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid?
3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid has a molecular weight of 326.23 g/mol, XLogP of 4.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(3,3-diethylpyrrolidin-1-yl)benzoic acid is sourced from PubChem (CID 82800705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).