C25H23F6N5O7 — CID 74763879
methyl N-[3-[[4-(aminomethyl)phenyl]carbamoyl]-7-carbamimidoylnaphthalen-1-yl]carbamate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 74763879) has the molecular formula C25H23F6N5O7 and a molecular weight of 619.48 g/mol. Its IUPAC name is methyl N-[3-[[4-(aminomethyl)phenyl]carbamoyl]-7-carbamimidoylnaphthalen-1-yl]carbamate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | methyl N-[3-[[4-(aminomethyl)phenyl]carbamoyl]-7-carbamimidoylnaphthalen-1-yl]carbamate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 74763879 |
| Molecular Formula | C25H23F6N5O7 |
| Molecular Weight | 619.48 g/mol |
| Exact Mass | 619.15 |
| IUPAC Name | methyl N-[3-[[4-(aminomethyl)phenyl]carbamoyl]-7-carbamimidoylnaphthalen-1-yl]carbamate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(C(=O)Nc3ccc(CN)cc3)cc(NC(=O)OC)c2c1 |
| InChI | InChI=1S/C21H21N5O3.2C2HF3O2/c1-29-21(28)26-18-10-15(8-13-4-5-14(19(23)24)9-17(13)18)20(27)25-16-6-2-12(11-22)3-7-16;2*3-2(4,5)1(6)7/h2-10H,11,22H2,1H3,(H3,23,24)(H,25,27)(H,26,28);2*(H,6,7) |
| InChIKey | PLKAISHCUNAUPJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 217.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|