C27H23F6N7O6 — CID 10305054
N-[4-(aminomethyl)phenyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10305054) has the molecular formula C27H23F6N7O6 and a molecular weight of 655.51 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[4-(aminomethyl)phenyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10305054 |
| Molecular Formula | C27H23F6N7O6 |
| Molecular Weight | 655.51 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCc1ccc(NC(=O)c2cc(Nc3ncccn3)c3cc(/C(N)=N/O)ccc3c2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H21N7O2.2C2HF3O2/c24-13-14-2-6-18(7-3-14)28-22(31)17-10-15-4-5-16(21(25)30-32)11-19(15)20(12-17)29-23-26-8-1-9-27-23;2*3-2(4,5)1(6)7/h1-12,32H,13,24H2,(H2,25,30)(H,28,31)(H,26,27,29);2*(H,6,7) |
| InChIKey | RSBVRVTZXMEMMN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 226.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|