C19H17N5O2 — CID 31861938
N-[4-(2-amino-2-oxoethyl)phenyl]-3-(pyrimidin-2-ylamino)benzamide (PubChem CID 31861938) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-3-(pyrimidin-2-ylamino)benzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-3-(pyrimidin-2-ylamino)benzamide |
|---|---|
| PubChem CID | 31861938 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-3-(pyrimidin-2-ylamino)benzamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)c2cccc(Nc3ncccn3)c2)cc1 |
| InChI | InChI=1S/C19H17N5O2/c20-17(25)11-13-5-7-15(8-6-13)23-18(26)14-3-1-4-16(12-14)24-19-21-9-2-10-22-19/h1-10,12H,11H2,(H2,20,25)(H,23,26)(H,21,22,24) |
| InChIKey | VPGJJRCKGQTOSL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |