C24H17F3N6O3 — CID 70063295
[6-carbamimidoyl-2-(phenylcarbamoyl)-4-(pyrimidin-2-ylamino)naphthalen-1-yl] 2,2,2-trifluoroacetate (PubChem CID 70063295) has the molecular formula C24H17F3N6O3 and a molecular weight of 494.43 g/mol. Its IUPAC name is [6-carbamimidoyl-2-(phenylcarbamoyl)-4-(pyrimidin-2-ylamino)naphthalen-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6-carbamimidoyl-2-(phenylcarbamoyl)-4-(pyrimidin-2-ylamino)naphthalen-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70063295 |
| Molecular Formula | C24H17F3N6O3 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [6-carbamimidoyl-2-(phenylcarbamoyl)-4-(pyrimidin-2-ylamino)naphthalen-1-yl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc2c(OC(=O)C(F)(F)F)c(C(=O)Nc3ccccc3)cc(Nc3ncccn3)c2c1 |
| InChI | InChI=1S/C24H17F3N6O3/c25-24(26,27)22(35)36-19-15-8-7-13(20(28)29)11-16(15)18(33-23-30-9-4-10-31-23)12-17(19)21(34)32-14-5-2-1-3-6-14/h1-12H,(H3,28,29)(H,32,34)(H,30,31,33) |
| InChIKey | ZDBMMEJHSSZLAM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|