C27H35ClN4O5S — CID 160915325
ethyl 2-[butylsulfonyl-[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]amino]acetate;hydrochloride (PubChem CID 160915325) has the molecular formula C27H35ClN4O5S and a molecular weight of 563.12 g/mol. Its IUPAC name is ethyl 2-[butylsulfonyl-[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]amino]acetate;hydrochloride.
| Compound Name | ethyl 2-[butylsulfonyl-[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 160915325 |
| Molecular Formula | C27H35ClN4O5S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | ethyl 2-[butylsulfonyl-[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]amino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCC(=O)c2cn(C)c3ccc(N(CC(=O)OCC)S(=O)(=O)CCCC)cc23)cc1 |
| InChI | InChI=1S/C27H34N4O5S.ClH/c1-4-6-15-37(34,35)31(18-26(33)36-5-2)21-12-13-24-22(16-21)23(17-30(24)3)25(32)14-9-19-7-10-20(11-8-19)27(28)29;/h7-8,10-13,16-17H,4-6,9,14-15,18H2,1-3H3,(H3,28,29);1H |
| InChIKey | AYNUMAVEGBETIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|