C25H19BrN4O3S — CID 23302369
4-[[3-bromo-6-(quinolin-8-ylsulfonylamino)-1-benzofuran-2-yl]methyl]benzenecarboximidamide (PubChem CID 23302369) has the molecular formula C25H19BrN4O3S and a molecular weight of 535.42 g/mol. Its IUPAC name is 4-[[3-bromo-6-(quinolin-8-ylsulfonylamino)-1-benzofuran-2-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[3-bromo-6-(quinolin-8-ylsulfonylamino)-1-benzofuran-2-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 23302369 |
| Molecular Formula | C25H19BrN4O3S |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 4-[[3-bromo-6-(quinolin-8-ylsulfonylamino)-1-benzofuran-2-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cc2oc3cc(NS(=O)(=O)c4cccc5cccnc45)ccc3c2Br)cc1 |
| InChI | InChI=1S/C25H19BrN4O3S/c26-23-19-11-10-18(30-34(31,32)22-5-1-3-16-4-2-12-29-24(16)22)14-20(19)33-21(23)13-15-6-8-17(9-7-15)25(27)28/h1-12,14,30H,13H2,(H3,27,28) |
| InChIKey | ZVRZIAMJGFYSCP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|