C29H43N7O — CID 142045245
N-(3-amino-3-methyliminopropyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N,1-dimethylbenzimidazole-5-carboxamide;hexane (PubChem CID 142045245) has the molecular formula C29H43N7O and a molecular weight of 505.71 g/mol. Its IUPAC name is N-(3-amino-3-methyliminopropyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N,1-dimethylbenzimidazole-5-carboxamide;hexane.
| Compound Name | N-(3-amino-3-methyliminopropyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N,1-dimethylbenzimidazole-5-carboxamide;hexane |
|---|---|
| PubChem CID | 142045245 |
| Molecular Formula | C29H43N7O |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | N-(3-amino-3-methyliminopropyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N,1-dimethylbenzimidazole-5-carboxamide;hexane |
| SMILES | CCCCCC.[H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(C)CC/C(N)=N/C)ccc3n2C)cc1 |
| InChI | InChI=1S/C23H29N7O.C6H14/c1-27-20(24)12-13-29(2)23(31)17-9-10-19-18(14-17)28-21(30(19)3)11-6-15-4-7-16(8-5-15)22(25)26;1-3-5-6-4-2/h4-5,7-10,14H,6,11-13H2,1-3H3,(H2,24,27)(H3,25,26);3-6H2,1-2H3 |
| InChIKey | BUTJZOPGOSFNSP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|