C26H25N5O5S — CID 19921352
methyl 3-[[2-(4-carbamimidoylphenyl)-1-(3-methylsulfonylphenyl)benzimidazole-5-carbonyl]amino]propanoate (PubChem CID 19921352) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is methyl 3-[[2-(4-carbamimidoylphenyl)-1-(3-methylsulfonylphenyl)benzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(4-carbamimidoylphenyl)-1-(3-methylsulfonylphenyl)benzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 19921352 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | methyl 3-[[2-(4-carbamimidoylphenyl)-1-(3-methylsulfonylphenyl)benzimidazole-5-carbonyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3cc(C(=O)NCCC(=O)OC)ccc3n2-c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C26H25N5O5S/c1-36-23(32)12-13-29-26(33)18-10-11-22-21(14-18)30-25(17-8-6-16(7-9-17)24(27)28)31(22)19-4-3-5-20(15-19)37(2,34)35/h3-11,14-15H,12-13H2,1-2H3,(H3,27,28)(H,29,33) |
| InChIKey | UJWKVRHGSBMFEW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 157.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|