About methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate
methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate (PubChem CID 19921419) has the molecular formula C22H24N4O3
and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
| PubChem CID | 19921419 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc2c(c1)nc(-c1ccc3c(c1)CCC3N)n2C |
| InChI | InChI=1S/C22H24N4O3/c1-26-19-8-5-15(22(28)24-10-9-20(27)29-2)12-18(19)25-21(26)14-3-6-16-13(11-14)4-7-17(16)23/h3,5-6,8,11-12,17H,4,7,9-10,23H2,1-2H3,(H,24,28) |
| InChIKey | YAFLBQRJQDZBSE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate?
The IUPAC name of methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate (CID 19921419) is methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate.
What is the SMILES notation for methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate?
The canonical SMILES for methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate is COC(=O)CCNC(=O)c1ccc2c(c1)nc(-c1ccc3c(c1)CCC3N)n2C.
What is the InChIKey of methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate?
The InChIKey is YAFLBQRJQDZBSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O3/c1-26-19-8-5-15(22(28)24-10-9-20(27)29-2)12-18(19)25-21(26)14-3-6-16-13(11-14)4-7-17(16)23/h3,5-6,8,11-12,17H,4,7,9-10,23H2,1-2H3,(H,24,28).
What are the key properties of methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate?
methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate has a molecular weight of 392.46 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(1-amino-2,3-dihydro-1H-inden-5-yl)-1-methylbenzimidazole-5-carbonyl]amino]propanoate is sourced from PubChem (CID 19921419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).