C28H30N6O6S — CID 135516560
methyl 3-[[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-methyl-6-[methyl-(4-methylphenyl)sulfonylamino]benzimidazole-5-carbonyl]amino]propanoate (PubChem CID 135516560) has the molecular formula C28H30N6O6S and a molecular weight of 578.65 g/mol. Its IUPAC name is methyl 3-[[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-methyl-6-[methyl-(4-methylphenyl)sulfonylamino]benzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-methyl-6-[methyl-(4-methylphenyl)sulfonylamino]benzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 135516560 |
| Molecular Formula | C28H30N6O6S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | methyl 3-[[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-methyl-6-[methyl-(4-methylphenyl)sulfonylamino]benzimidazole-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1cc2nc(-c3ccc(/C(N)=N\O)cc3)n(C)c2cc1N(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H30N6O6S/c1-17-5-11-20(12-6-17)41(38,39)34(3)23-16-24-22(15-21(23)28(36)30-14-13-25(35)40-4)31-27(33(24)2)19-9-7-18(8-10-19)26(29)32-37/h5-12,15-16,37H,13-14H2,1-4H3,(H2,29,32)(H,30,36) |
| InChIKey | XVTDXZDOQLVJPI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|