C24H29N5O3 — CID 19921386
methyl 3-[[2-[2-(N'-butylcarbamimidoyl)phenyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate (PubChem CID 19921386) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is methyl 3-[[2-[2-(N'-butylcarbamimidoyl)phenyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[2-[2-(N'-butylcarbamimidoyl)phenyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 19921386 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | methyl 3-[[2-[2-(N'-butylcarbamimidoyl)phenyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
| SMILES | CCCC/N=C(\N)c1ccccc1-c1nc2cc(C(=O)NCCC(=O)OC)ccc2n1C |
| InChI | InChI=1S/C24H29N5O3/c1-4-5-13-26-22(25)17-8-6-7-9-18(17)23-28-19-15-16(10-11-20(19)29(23)2)24(31)27-14-12-21(30)32-3/h6-11,15H,4-5,12-14H2,1-3H3,(H2,25,26)(H,27,31) |
| InChIKey | YKUDYEVUXXFFAJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|