C22H23N5O3 — CID 118041670
ethyl 3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate (PubChem CID 118041670) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 118041670 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl 3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccc2c(c1)nc(CNc1ccc(C#N)cc1)n2C |
| InChI | InChI=1S/C22H23N5O3/c1-3-30-21(28)10-11-24-22(29)16-6-9-19-18(12-16)26-20(27(19)2)14-25-17-7-4-15(13-23)5-8-17/h4-9,12,25H,3,10-11,14H2,1-2H3,(H,24,29) |
| InChIKey | NQQBRQGWCMSCIK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |