About methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride
methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride (PubChem CID 19921247) has the molecular formula C20H23ClN4O3
and a molecular weight of 402.88 g/mol. Its IUPAC name is methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride |
| PubChem CID | 19921247 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride |
| SMILES | COC(=O)CCCNC(=O)c1ccc2c(c1)nc(-c1cccc(N)c1)n2C.Cl |
| InChI | InChI=1S/C20H22N4O3.ClH/c1-24-17-9-8-14(20(26)22-10-4-7-18(25)27-2)12-16(17)23-19(24)13-5-3-6-15(21)11-13;/h3,5-6,8-9,11-12H,4,7,10,21H2,1-2H3,(H,22,26);1H |
| InChIKey | HXKOUQSILMMGLU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride?
The IUPAC name of methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride (CID 19921247) is methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride.
What is the SMILES notation for methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride?
The canonical SMILES for methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride is COC(=O)CCCNC(=O)c1ccc2c(c1)nc(-c1cccc(N)c1)n2C.Cl.
What is the InChIKey of methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride?
The InChIKey is HXKOUQSILMMGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3.ClH/c1-24-17-9-8-14(20(26)22-10-4-7-18(25)27-2)12-16(17)23-19(24)13-5-3-6-15(21)11-13;/h3,5-6,8-9,11-12H,4,7,10,21H2,1-2H3,(H,22,26);1H.
What are the key properties of methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride?
methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride has a molecular weight of 402.88 g/mol, XLogP of 2.93, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(3-aminophenyl)-1-methylbenzimidazole-5-carbonyl]amino]butanoate;hydrochloride is sourced from PubChem (CID 19921247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).