C18H19N7O5 — CID 67806188
2-[[2-[8-(4-carbamimidoylphenyl)-3-methyl-2,6-dioxo-7H-purin-1-yl]acetyl]-methylamino]acetic acid (PubChem CID 67806188) has the molecular formula C18H19N7O5 and a molecular weight of 413.39 g/mol. Its IUPAC name is 2-[[2-[8-(4-carbamimidoylphenyl)-3-methyl-2,6-dioxo-7H-purin-1-yl]acetyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-[8-(4-carbamimidoylphenyl)-3-methyl-2,6-dioxo-7H-purin-1-yl]acetyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 67806188 |
| Molecular Formula | C18H19N7O5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[[2-[8-(4-carbamimidoylphenyl)-3-methyl-2,6-dioxo-7H-purin-1-yl]acetyl]-methylamino]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3c([nH]2)c(=O)n(CC(=O)N(C)CC(=O)O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H19N7O5/c1-23(8-12(27)28)11(26)7-25-17(29)13-16(24(2)18(25)30)22-15(21-13)10-5-3-9(4-6-10)14(19)20/h3-6H,7-8H2,1-2H3,(H3,19,20)(H,21,22)(H,27,28) |
| InChIKey | VTEDLMPCGVWKAU-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|