C18H20N7O4+ — CID 54344935
[2-[8-(4-carbamimidoylphenyl)-6-oxo-7H-purin-1-yl]acetyl]-methoxycarbonyl-dimethylazanium (PubChem CID 54344935) has the molecular formula C18H20N7O4+ and a molecular weight of 398.40 g/mol. Its IUPAC name is [2-[8-(4-carbamimidoylphenyl)-6-oxo-7H-purin-1-yl]acetyl]-methoxycarbonyl-dimethylazanium.
| Compound Name | [2-[8-(4-carbamimidoylphenyl)-6-oxo-7H-purin-1-yl]acetyl]-methoxycarbonyl-dimethylazanium |
|---|---|
| PubChem CID | 54344935 |
| Molecular Formula | C18H20N7O4+ |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-[8-(4-carbamimidoylphenyl)-6-oxo-7H-purin-1-yl]acetyl]-methoxycarbonyl-dimethylazanium |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3ncn(CC(=O)[N+](C)(C)C(=O)OC)c(=O)c3[nH]2)cc1 |
| InChI | InChI=1S/C18H19N7O4/c1-25(2,18(28)29-3)12(26)8-24-9-21-16-13(17(24)27)22-15(23-16)11-6-4-10(5-7-11)14(19)20/h4-7,9H,8H2,1-3H3,(H3-,19,20,22,23,27)/p+1 |
| InChIKey | JRCJDKUFOOWLLJ-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 156.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|